C34H49FO3 — CID 145121885
(3Z,7E,11Z)-8-fluoro-2-methoxy-4-(2-methoxyethyl)-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene;(E)-2-methylbut-2-enal (PubChem CID 145121885) has the molecular formula C34H49FO3 and a molecular weight of 524.76 g/mol. Its IUPAC name is (3Z,7E,11Z)-8-fluoro-2-methoxy-4-(2-methoxyethyl)-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene;(E)-2-methylbut-2-enal.
| Compound Name | (3Z,7E,11Z)-8-fluoro-2-methoxy-4-(2-methoxyethyl)-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene;(E)-2-methylbut-2-enal |
|---|---|
| PubChem CID | 145121885 |
| Molecular Formula | C34H49FO3 |
| Molecular Weight | 524.76 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | (3Z,7E,11Z)-8-fluoro-2-methoxy-4-(2-methoxyethyl)-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene;(E)-2-methylbut-2-enal |
| SMILES | C/C=C(\C)C=O.C=C(/C=C(/CCOC)C(=C)C(=C)/C=C(/F)C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)C)OC |
| InChI | InChI=1S/C29H41FO2.C5H8O/c1-20(2)12-13-21(3)22(4)14-15-23(5)27(9)29(30)18-24(6)26(8)28(16-17-31-10)19-25(7)32-11;1-3-5(2)4-6/h14-15,18-21H,4-9,12-13,16-17H2,1-3,10-11H3;3-4H,1-2H3/b15-14-,28-19-,29-18+;5-3+ |
| InChIKey | GTUHDHGBZNOCSD-MERQNVJKSA-N |
| XLogP | 9.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.76 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|