C22H38O3 — CID 145122629
(Z)-1-methoxy-4-(1-methoxyethenyl)-7,10-dimethyl-6-methylideneundec-4-ene;2-methylprop-2-enal (PubChem CID 145122629) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is (Z)-1-methoxy-4-(1-methoxyethenyl)-7,10-dimethyl-6-methylideneundec-4-ene;2-methylprop-2-enal.
| Compound Name | (Z)-1-methoxy-4-(1-methoxyethenyl)-7,10-dimethyl-6-methylideneundec-4-ene;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145122629 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | (Z)-1-methoxy-4-(1-methoxyethenyl)-7,10-dimethyl-6-methylideneundec-4-ene;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.C=C(OC)/C(=C\C(=C)C(C)CCC(C)C)CCCOC |
| InChI | InChI=1S/C18H32O2.C4H6O/c1-14(2)10-11-15(3)16(4)13-18(17(5)20-7)9-8-12-19-6;1-4(2)3-5/h13-15H,4-5,8-12H2,1-3,6-7H3;3H,1H2,2H3/b18-13-; |
| InChIKey | HBDGSOMPYXAFSM-AAKIMCHBSA-N |
| XLogP | 5.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|