C28H46O3 — CID 145122919
acetaldehyde;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;prop-1-ene (PubChem CID 145122919) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is acetaldehyde;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;prop-1-ene.
| Compound Name | acetaldehyde;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;prop-1-ene |
|---|---|
| PubChem CID | 145122919 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | acetaldehyde;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;prop-1-ene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C)C(=C)/C=C(/CCOC)C(=C)OC.C=CC.CC=O |
| InChI | InChI=1S/C23H36O2.C3H6.C2H4O/c1-17(2)10-11-18(3)19(4)12-13-20(5)21(6)16-23(14-15-24-8)22(7)25-9;1-3-2;1-2-3/h12-13,16-18H,4-7,10-11,14-15H2,1-3,8-9H3;3H,1H2,2H3;2H,1H3/b13-12-,23-16-;; |
| InChIKey | ROJNZNCOVVEKHN-BGWNIYMDSA-N |
| XLogP | 7.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|