C27H38O3 — CID 145122419
(3R)-3-[(3Z,7E)-9-methoxy-7-(methoxymethyl)-4-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;2-methylprop-2-enal (PubChem CID 145122419) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is (3R)-3-[(3Z,7E)-9-methoxy-7-(methoxymethyl)-4-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;2-methylprop-2-enal.
| Compound Name | (3R)-3-[(3Z,7E)-9-methoxy-7-(methoxymethyl)-4-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145122419 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | (3R)-3-[(3Z,7E)-9-methoxy-7-(methoxymethyl)-4-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;2-methylprop-2-enal |
| SMILES | C=C(/C=C(/COC)C(=C)C(=C)/C(C)=C\C(=C)[C@@]1(C)C=CC(C)C1)OC.C=C(C)C=O |
| InChI | InChI=1S/C23H32O2.C4H6O/c1-16-10-11-23(7,14-16)18(3)12-17(2)20(5)21(6)22(15-24-8)13-19(4)25-9;1-4(2)3-5/h10-13,16H,3-6,14-15H2,1-2,7-9H3;3H,1H2,2H3/b17-12-,22-13-;/t16?,23-;/m0./s1 |
| InChIKey | HLMAKKNIEJZEOD-TUIPHNLRSA-N |
| XLogP | 6.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|