C29H43FO3 — CID 145122950
acetaldehyde;(5S)-1-fluoro-5-[(3Z,7Z)-11-methoxy-8-(1-methoxyethenyl)-5,6-dimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;prop-1-ene (PubChem CID 145122950) has the molecular formula C29H43FO3 and a molecular weight of 458.66 g/mol. Its IUPAC name is acetaldehyde;(5S)-1-fluoro-5-[(3Z,7Z)-11-methoxy-8-(1-methoxyethenyl)-5,6-dimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;prop-1-ene.
| Compound Name | acetaldehyde;(5S)-1-fluoro-5-[(3Z,7Z)-11-methoxy-8-(1-methoxyethenyl)-5,6-dimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;prop-1-ene |
|---|---|
| PubChem CID | 145122950 |
| Molecular Formula | C29H43FO3 |
| Molecular Weight | 458.66 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | acetaldehyde;(5S)-1-fluoro-5-[(3Z,7Z)-11-methoxy-8-(1-methoxyethenyl)-5,6-dimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;prop-1-ene |
| SMILES | C=C(/C=C\C(=C)[C@]1(C)CC(C)C=C1F)C(=C)/C=C(/CCCOC)C(=C)OC.C=CC.CC=O |
| InChI | InChI=1S/C24H33FO2.C3H6.C2H4O/c1-17-14-23(25)24(6,16-17)20(4)12-11-18(2)19(3)15-22(21(5)27-8)10-9-13-26-7;1-3-2;1-2-3/h11-12,14-15,17H,2-5,9-10,13,16H2,1,6-8H3;3H,1H2,2H3;2H,1H3/b12-11-,22-15-;;/t17?,24-;;/m0../s1 |
| InChIKey | MSYFLODDUUUZPQ-UJSKWYFTSA-N |
| XLogP | 8.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.66 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|