C30H48O3 — CID 145121951
formaldehyde;(4Z,8Z,12Z)-1-methoxy-4-(1-methoxyethenyl)-9,11,14-trimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene;prop-1-ene (PubChem CID 145121951) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is formaldehyde;(4Z,8Z,12Z)-1-methoxy-4-(1-methoxyethenyl)-9,11,14-trimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene;prop-1-ene.
| Compound Name | formaldehyde;(4Z,8Z,12Z)-1-methoxy-4-(1-methoxyethenyl)-9,11,14-trimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene;prop-1-ene |
|---|---|
| PubChem CID | 145121951 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | formaldehyde;(4Z,8Z,12Z)-1-methoxy-4-(1-methoxyethenyl)-9,11,14-trimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene;prop-1-ene |
| SMILES | C=C(/C=C(/C)C(=C)C(C)/C=C\C(C)CC)C(=C)/C=C(/CCCOC)C(=C)OC.C=CC.C=O |
| InChI | InChI=1S/C26H40O2.C3H6.CH2O/c1-11-19(2)14-15-20(3)24(7)23(6)17-21(4)22(5)18-26(25(8)28-10)13-12-16-27-9;1-3-2;1-2/h14-15,17-20H,4-5,7-8,11-13,16H2,1-3,6,9-10H3;3H,1H2,2H3;1H2/b15-14-,23-17-,26-18-;; |
| InChIKey | UUOOEWSHFGOZMW-BWOCKUCDSA-N |
| XLogP | 8.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|