C25H45KO2 — CID 153404554
potassium;ethane;(5E,7Z)-4-(5-ethoxy-3-methylpentoxy)-6-propan-2-yldodeca-3,5,7,9-tetraene (PubChem CID 153404554) has the molecular formula C25H45KO2 and a molecular weight of 416.73 g/mol. Its IUPAC name is potassium;ethane;(5E,7Z)-4-(5-ethoxy-3-methylpentoxy)-6-propan-2-yldodeca-3,5,7,9-tetraene.
| Compound Name | potassium;ethane;(5E,7Z)-4-(5-ethoxy-3-methylpentoxy)-6-propan-2-yldodeca-3,5,7,9-tetraene |
|---|---|
| PubChem CID | 153404554 |
| Molecular Formula | C25H45KO2 |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | potassium;ethane;(5E,7Z)-4-(5-ethoxy-3-methylpentoxy)-6-propan-2-yldodeca-3,5,7,9-tetraene |
| SMILES | CC.CC/[C-]=C(/C=C(/C=C\C=CCC)C(C)C)OCCC(C)CCOCC.[K+] |
| InChI | InChI=1S/C23H39O2.C2H6.K/c1-7-10-11-12-14-22(20(4)5)19-23(13-8-2)25-18-16-21(6)15-17-24-9-3;1-2;/h10-12,14,19-21H,7-9,15-18H2,1-6H3;1-2H3;/q-1;;+1/b11-10?,14-12-,22-19-;; |
| InChIKey | DKMWKTXJPCRPGL-HWBKBGLASA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|