C27H42O — CID 129308690
(7Z,9E,11E)-9-[(E)-2,3-dimethyl-4-methylidenehex-2-enoxy]-4-ethyl-3,12-dimethyltetradeca-1,2,7,9,11-pentaene (PubChem CID 129308690) has the molecular formula C27H42O and a molecular weight of 382.63 g/mol. Its IUPAC name is (7Z,9E,11E)-9-[(E)-2,3-dimethyl-4-methylidenehex-2-enoxy]-4-ethyl-3,12-dimethyltetradeca-1,2,7,9,11-pentaene.
| Compound Name | (7Z,9E,11E)-9-[(E)-2,3-dimethyl-4-methylidenehex-2-enoxy]-4-ethyl-3,12-dimethyltetradeca-1,2,7,9,11-pentaene |
|---|---|
| PubChem CID | 129308690 |
| Molecular Formula | C27H42O |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.32 |
| IUPAC Name | (7Z,9E,11E)-9-[(E)-2,3-dimethyl-4-methylidenehex-2-enoxy]-4-ethyl-3,12-dimethyltetradeca-1,2,7,9,11-pentaene |
| SMILES | C=C=C(C)C(CC)CC/C=C\C(=C/C=C(\C)CC)OC/C(C)=C(\C)C(=C)CC |
| InChI | InChI=1S/C27H42O/c1-10-21(5)18-19-27(28-20-24(8)25(9)22(6)11-2)17-15-14-16-26(13-4)23(7)12-3/h15,17-19,26H,3,6,10-11,13-14,16,20H2,1-2,4-5,7-9H3/b17-15-,21-18+,25-24+,27-19+ |
| InChIKey | XWPOTUOECVCZLK-XNEGFEDKSA-N |
| XLogP | 8.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|