C27H32F4O — CID 143772429
(3Z,7Z,11Z)-3,4,11,12-tetrafluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxyoctadeca-1,3,7,11-tetraene (PubChem CID 143772429) has the molecular formula C27H32F4O and a molecular weight of 448.54 g/mol. Its IUPAC name is (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxyoctadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxyoctadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143772429 |
| Molecular Formula | C27H32F4O |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxyoctadeca-1,3,7,11-tetraene |
| SMILES | C=CCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)C(C)CCCC |
| InChI | InChI=1S/C27H32F4O/c1-10-12-13-17(3)20(6)24(28)25(29)21(7)18(4)14-15-19(5)22(8)26(30)27(31)23(9)32-16-11-2/h11,14-15,17H,2,4-10,12-13,16H2,1,3H3/b15-14-,25-24-,27-26- |
| InChIKey | FJCICIRGLQYLTM-VWLIUOCNSA-N |
| XLogP | 9.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|