C28H42F4O — CID 88953178
3-(4-ethenylcyclohexyl)-6-[(6Z,8E)-8-ethoxy-4-ethyl-6,7-difluorodeca-6,8-dienyl]-1,2-difluorocyclohexene (PubChem CID 88953178) has the molecular formula C28H42F4O and a molecular weight of 470.64 g/mol. Its IUPAC name is 3-(4-ethenylcyclohexyl)-6-[(6Z,8E)-8-ethoxy-4-ethyl-6,7-difluorodeca-6,8-dienyl]-1,2-difluorocyclohexene.
| Compound Name | 3-(4-ethenylcyclohexyl)-6-[(6Z,8E)-8-ethoxy-4-ethyl-6,7-difluorodeca-6,8-dienyl]-1,2-difluorocyclohexene |
|---|---|
| PubChem CID | 88953178 |
| Molecular Formula | C28H42F4O |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 3-(4-ethenylcyclohexyl)-6-[(6Z,8E)-8-ethoxy-4-ethyl-6,7-difluorodeca-6,8-dienyl]-1,2-difluorocyclohexene |
| SMILES | C=CC1CCC(C2CCC(CCCC(CC)C/C(F)=C(F)\C(=C/C)OCC)C(F)=C2F)CC1 |
| InChI | InChI=1S/C28H42F4O/c1-5-19-12-14-21(15-13-19)23-17-16-22(26(30)27(23)31)11-9-10-20(6-2)18-24(29)28(32)25(7-3)33-8-4/h5,7,19-23H,1,6,8-18H2,2-4H3/b25-7+,28-24- |
| InChIKey | GSSKJFYDZDIBHZ-JQNMQRDRSA-N |
| XLogP | 9.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|