C26H40O2 — CID 145121952
(4Z,8Z,12Z)-1-methoxy-4-(1-methoxyethenyl)-9,11,14-trimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene (PubChem CID 145121952) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is (4Z,8Z,12Z)-1-methoxy-4-(1-methoxyethenyl)-9,11,14-trimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene.
| Compound Name | (4Z,8Z,12Z)-1-methoxy-4-(1-methoxyethenyl)-9,11,14-trimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene |
|---|---|
| PubChem CID | 145121952 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | (4Z,8Z,12Z)-1-methoxy-4-(1-methoxyethenyl)-9,11,14-trimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene |
| SMILES | C=C(/C=C(/C)C(=C)C(C)/C=C\C(C)CC)C(=C)/C=C(/CCCOC)C(=C)OC |
| InChI | InChI=1S/C26H40O2/c1-11-19(2)14-15-20(3)24(7)23(6)17-21(4)22(5)18-26(25(8)28-10)13-12-16-27-9/h14-15,17-20H,4-5,7-8,11-13,16H2,1-3,6,9-10H3/b15-14-,23-17-,26-18- |
| InChIKey | UYNVZAFERIIDGP-WHXDIPPKSA-N |
| XLogP | 7.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|