C26H48O2 — CID 143347928
ethane;(2E,4Z,6Z)-5-ethenyl-2-methoxyocta-2,4,6-triene;(2Z,4Z)-5-(methoxymethyl)-6-methylocta-2,4-diene (PubChem CID 143347928) has the molecular formula C26H48O2 and a molecular weight of 392.67 g/mol. Its IUPAC name is ethane;(2E,4Z,6Z)-5-ethenyl-2-methoxyocta-2,4,6-triene;(2Z,4Z)-5-(methoxymethyl)-6-methylocta-2,4-diene.
| Compound Name | ethane;(2E,4Z,6Z)-5-ethenyl-2-methoxyocta-2,4,6-triene;(2Z,4Z)-5-(methoxymethyl)-6-methylocta-2,4-diene |
|---|---|
| PubChem CID | 143347928 |
| Molecular Formula | C26H48O2 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.37 |
| IUPAC Name | ethane;(2E,4Z,6Z)-5-ethenyl-2-methoxyocta-2,4,6-triene;(2Z,4Z)-5-(methoxymethyl)-6-methylocta-2,4-diene |
| SMILES | C/C=C\C=C(/COC)C(C)CC.C=CC(/C=C\C)=C/C=C(\C)OC.CC.CC |
| InChI | InChI=1S/C11H16O.C11H20O.2C2H6/c1-5-7-11(6-2)9-8-10(3)12-4;1-5-7-8-11(9-12-4)10(3)6-2;2*1-2/h5-9H,2H2,1,3-4H3;5,7-8,10H,6,9H2,1-4H3;2*1-2H3/b7-5-,10-8+,11-9-;7-5-,11-8+;; |
| InChIKey | LGALOWQKTHIZCI-FRTWOMINSA-N |
| XLogP | 8.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|