C30H47FO3 — CID 145122520
acetaldehyde;(4Z,8E,12Z)-8-fluoro-1-methoxy-4-(1-methoxyethenyl)-11,14-dimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene;prop-1-ene (PubChem CID 145122520) has the molecular formula C30H47FO3 and a molecular weight of 474.70 g/mol. Its IUPAC name is acetaldehyde;(4Z,8E,12Z)-8-fluoro-1-methoxy-4-(1-methoxyethenyl)-11,14-dimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene;prop-1-ene.
| Compound Name | acetaldehyde;(4Z,8E,12Z)-8-fluoro-1-methoxy-4-(1-methoxyethenyl)-11,14-dimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene;prop-1-ene |
|---|---|
| PubChem CID | 145122520 |
| Molecular Formula | C30H47FO3 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | acetaldehyde;(4Z,8E,12Z)-8-fluoro-1-methoxy-4-(1-methoxyethenyl)-11,14-dimethyl-6,7,10-trimethylidenehexadeca-4,8,12-triene;prop-1-ene |
| SMILES | C=C(/C=C(/CCCOC)C(=C)OC)C(=C)/C(F)=C/C(=C)C(C)/C=C\C(C)CC.C=CC.CC=O |
| InChI | InChI=1S/C25H37FO2.C3H6.C2H4O/c1-10-18(2)13-14-19(3)20(4)17-25(26)22(6)21(5)16-24(23(7)28-9)12-11-15-27-8;1-3-2;1-2-3/h13-14,16-19H,4-7,10-12,15H2,1-3,8-9H3;3H,1H2,2H3;2H,1H3/b14-13-,24-16-,25-17+;; |
| InChIKey | YTANQNJRFBKZJG-YGCBOCPHSA-N |
| XLogP | 8.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|