C22H33FO3 — CID 145122775
acetaldehyde;(3Z,7E)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;prop-1-ene (PubChem CID 145122775) has the molecular formula C22H33FO3 and a molecular weight of 364.50 g/mol. Its IUPAC name is acetaldehyde;(3Z,7E)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;prop-1-ene.
| Compound Name | acetaldehyde;(3Z,7E)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;prop-1-ene |
|---|---|
| PubChem CID | 145122775 |
| Molecular Formula | C22H33FO3 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | acetaldehyde;(3Z,7E)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;prop-1-ene |
| SMILES | C=C(C)/C=C(/F)C(=C)C(=C)/C(=C\C(=C)OC)CCOC.C=CC.CC=O |
| InChI | InChI=1S/C17H23FO2.C3H6.C2H4O/c1-12(2)10-17(18)15(5)14(4)16(8-9-19-6)11-13(3)20-7;1-3-2;1-2-3/h10-11H,1,3-5,8-9H2,2,6-7H3;3H,1H2,2H3;2H,1H3/b16-11-,17-10+;; |
| InChIKey | ARZYRWXXHWZGKR-HPPQASNISA-N |
| XLogP | 6.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|