C24H31FO2 — CID 145122388
(3Z,7E,11Z)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene (PubChem CID 145122388) has the molecular formula C24H31FO2 and a molecular weight of 370.51 g/mol. Its IUPAC name is (3Z,7E,11Z)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7E,11Z)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 145122388 |
| Molecular Formula | C24H31FO2 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (3Z,7E,11Z)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(/F)C(=C)C(=C)/C(=C\C(=C)OC)CCOC)CC |
| InChI | InChI=1S/C24H31FO2/c1-10-17(2)11-12-18(3)19(4)15-24(25)22(7)21(6)23(13-14-26-8)16-20(5)27-9/h11-12,15-16H,2-7,10,13-14H2,1,8-9H3/b12-11-,23-16-,24-15+ |
| InChIKey | NZXPLYJDAZOKOX-HIZCDICOSA-N |
| XLogP | 6.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|