C17H23FO2 — CID 145122776
(3Z,7E)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene (PubChem CID 145122776) has the molecular formula C17H23FO2 and a molecular weight of 278.37 g/mol. Its IUPAC name is (3Z,7E)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene.
| Compound Name | (3Z,7E)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 145122776 |
| Molecular Formula | C17H23FO2 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (3Z,7E)-7-fluoro-2-methoxy-4-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene |
| SMILES | C=C(C)/C=C(/F)C(=C)C(=C)/C(=C\C(=C)OC)CCOC |
| InChI | InChI=1S/C17H23FO2/c1-12(2)10-17(18)15(5)14(4)16(8-9-19-6)11-13(3)20-7/h10-11H,1,3-5,8-9H2,2,6-7H3/b16-11-,17-10+ |
| InChIKey | YGLFLTBXKSAENW-KQRVFROYSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|