C17H18MoO6 — CID 135047606
carbon monoxide;[1-(6-methyl-3,4-dihydro-2H-pyran-5-yl)-2-[(2E)-penta-2,4-dienoxy]ethylidene]molybdenum (PubChem CID 135047606) has the molecular formula C17H18MoO6 and a molecular weight of 414.27 g/mol. Its IUPAC name is carbon monoxide;[1-(6-methyl-3,4-dihydro-2H-pyran-5-yl)-2-[(2E)-penta-2,4-dienoxy]ethylidene]molybdenum.
| Compound Name | carbon monoxide;[1-(6-methyl-3,4-dihydro-2H-pyran-5-yl)-2-[(2E)-penta-2,4-dienoxy]ethylidene]molybdenum |
|---|---|
| PubChem CID | 135047606 |
| Molecular Formula | C17H18MoO6 |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | carbon monoxide;[1-(6-methyl-3,4-dihydro-2H-pyran-5-yl)-2-[(2E)-penta-2,4-dienoxy]ethylidene]molybdenum |
| SMILES | C=C/C=C/COCC(=[Mo])C1=C(C)OCCC1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C13H18O2.4CO.Mo/c1-3-4-5-9-14-11-8-13-7-6-10-15-12(13)2;4*1-2;/h3-5H,1,6-7,9-11H2,2H3;;;;;/b5-4+;;;;; |
| InChIKey | WWCJIQDKGBWMRU-FNMVVZLKSA-N |
| XLogP | 2.40 |
| TPSA | 98.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|