C13H18O — CID 6428798
(3Z)-3-pentylidene-4,5-dihydro-1H-2-benzofuran (PubChem CID 6428798) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (3Z)-3-pentylidene-4,5-dihydro-1H-2-benzofuran.
| Compound Name | (3Z)-3-pentylidene-4,5-dihydro-1H-2-benzofuran |
|---|---|
| PubChem CID | 6428798 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (3Z)-3-pentylidene-4,5-dihydro-1H-2-benzofuran |
| SMILES | CCCC/C=C1\OCC2=C1CCC=C2 |
| InChI | InChI=1S/C13H18O/c1-2-3-4-9-13-12-8-6-5-7-11(12)10-14-13/h5,7,9H,2-4,6,8,10H2,1H3/b13-9- |
| InChIKey | ZLAFQLXVGWHNRT-LCYFTJDESA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|