C10H16O2 — CID 134985663
1-[(Z)-1,2-dimethoxyethenyl]cyclohexene (PubChem CID 134985663) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-[(Z)-1,2-dimethoxyethenyl]cyclohexene.
| Compound Name | 1-[(Z)-1,2-dimethoxyethenyl]cyclohexene |
|---|---|
| PubChem CID | 134985663 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1-[(Z)-1,2-dimethoxyethenyl]cyclohexene |
| SMILES | CO/C=C(\OC)C1=CCCCC1 |
| InChI | InChI=1S/C10H16O2/c1-11-8-10(12-2)9-6-4-3-5-7-9/h6,8H,3-5,7H2,1-2H3/b10-8- |
| InChIKey | HCTUVAIGXPLXLL-NTMALXAHSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|