C20H28O6 — CID 91247030
2,10,13,17,20,24-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),11,22-tetraene (PubChem CID 91247030) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2,10,13,17,20,24-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),11,22-tetraene.
| Compound Name | 2,10,13,17,20,24-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),11,22-tetraene |
|---|---|
| PubChem CID | 91247030 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2,10,13,17,20,24-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),11,22-tetraene |
| SMILES | C1=COC2=C(CCCCCCOC3=CCOC=C3COCCOCC2)O1 |
| InChI | InChI=1S/C20H28O6/c1-2-4-8-24-18-6-10-22-15-17(18)16-23-12-11-21-9-7-20-19(5-3-1)25-13-14-26-20/h6,13-15H,1-5,7-12,16H2 |
| InChIKey | XTJDSBFNAXXFCQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |