C16H21FO — CID 144902482
(4E)-5-fluoro-2-methyl-8-(3-methylbuta-1,3-dien-2-yloxy)-3,6-dimethylideneocta-1,4-diene (PubChem CID 144902482) has the molecular formula C16H21FO and a molecular weight of 248.34 g/mol. Its IUPAC name is (4E)-5-fluoro-2-methyl-8-(3-methylbuta-1,3-dien-2-yloxy)-3,6-dimethylideneocta-1,4-diene.
| Compound Name | (4E)-5-fluoro-2-methyl-8-(3-methylbuta-1,3-dien-2-yloxy)-3,6-dimethylideneocta-1,4-diene |
|---|---|
| PubChem CID | 144902482 |
| Molecular Formula | C16H21FO |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (4E)-5-fluoro-2-methyl-8-(3-methylbuta-1,3-dien-2-yloxy)-3,6-dimethylideneocta-1,4-diene |
| SMILES | C=C(C)C(=C)/C=C(/F)C(=C)CCOC(=C)C(=C)C |
| InChI | InChI=1S/C16H21FO/c1-11(2)14(6)10-16(17)13(5)8-9-18-15(7)12(3)4/h10H,1,3,5-9H2,2,4H3/b16-10+ |
| InChIKey | ZSXHSYASZSCSRB-MHWRWJLKSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|