C13H21FO2 — CID 142462037
(3Z,4E)-2-ethoxy-3-(ethoxymethylidene)-5-fluoro-4-methylhepta-1,4-diene (PubChem CID 142462037) has the molecular formula C13H21FO2 and a molecular weight of 228.31 g/mol. Its IUPAC name is (3Z,4E)-2-ethoxy-3-(ethoxymethylidene)-5-fluoro-4-methylhepta-1,4-diene.
| Compound Name | (3Z,4E)-2-ethoxy-3-(ethoxymethylidene)-5-fluoro-4-methylhepta-1,4-diene |
|---|---|
| PubChem CID | 142462037 |
| Molecular Formula | C13H21FO2 |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (3Z,4E)-2-ethoxy-3-(ethoxymethylidene)-5-fluoro-4-methylhepta-1,4-diene |
| SMILES | C=C(OCC)C(=C\OCC)/C(C)=C(/F)CC |
| InChI | InChI=1S/C13H21FO2/c1-6-13(14)10(4)12(9-15-7-2)11(5)16-8-3/h9H,5-8H2,1-4H3/b12-9-,13-10+ |
| InChIKey | BKXVDXLFICPAAQ-TVRQEHKRSA-N |
| XLogP | 4.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|