C24H36O4 — CID 145122493
(3Z,7E)-2-ethoxy-4-ethyl-8-(2-methoxyethoxy)-5,6,9-trimethylideneundeca-1,3,7-triene;prop-2-enal (PubChem CID 145122493) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (3Z,7E)-2-ethoxy-4-ethyl-8-(2-methoxyethoxy)-5,6,9-trimethylideneundeca-1,3,7-triene;prop-2-enal.
| Compound Name | (3Z,7E)-2-ethoxy-4-ethyl-8-(2-methoxyethoxy)-5,6,9-trimethylideneundeca-1,3,7-triene;prop-2-enal |
|---|---|
| PubChem CID | 145122493 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (3Z,7E)-2-ethoxy-4-ethyl-8-(2-methoxyethoxy)-5,6,9-trimethylideneundeca-1,3,7-triene;prop-2-enal |
| SMILES | C=C(/C=C(/CC)C(=C)C(=C)/C=C(/OCCOC)C(=C)CC)OCC.C=CC=O |
| InChI | InChI=1S/C21H32O3.C3H4O/c1-9-16(4)21(24-13-12-22-8)14-17(5)19(7)20(10-2)15-18(6)23-11-3;1-2-3-4/h14-15H,4-7,9-13H2,1-3,8H3;2-3H,1H2/b20-15-,21-14+; |
| InChIKey | IBZQTOMVBARBTO-NBXXUOBUSA-N |
| XLogP | 5.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|