C28H38O4 — CID 145122569
(3E,7Z,11Z)-13-methoxy-3-(2-methoxyethoxy)-2,8-dimethyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene;2-methylprop-2-enal (PubChem CID 145122569) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is (3E,7Z,11Z)-13-methoxy-3-(2-methoxyethoxy)-2,8-dimethyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene;2-methylprop-2-enal.
| Compound Name | (3E,7Z,11Z)-13-methoxy-3-(2-methoxyethoxy)-2,8-dimethyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145122569 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (3E,7Z,11Z)-13-methoxy-3-(2-methoxyethoxy)-2,8-dimethyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene;2-methylprop-2-enal |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(C)=C/C(=C)C(=C)/C=C(/OCCOC)C(=C)C)OC.C=C(C)C=O |
| InChI | InChI=1S/C24H32O3.C4H6O/c1-17(2)24(27-14-13-25-9)16-20(5)19(4)15-21(6)23(8)18(3)11-12-22(7)26-10;1-4(2)3-5/h11-12,15-16H,1,3-5,7-8,13-14H2,2,6,9-10H3;3H,1H2,2H3/b12-11-,21-15-,24-16+; |
| InChIKey | FMCKHEWDPDYXQL-LFKIPQGPSA-N |
| XLogP | 6.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|