C29H44O4 — CID 145122350
(3E,7Z,11Z)-2-methoxy-3-(2-methoxyethoxy)-7,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;2-methylprop-2-enal (PubChem CID 145122350) has the molecular formula C29H44O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is (3E,7Z,11Z)-2-methoxy-3-(2-methoxyethoxy)-7,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;2-methylprop-2-enal.
| Compound Name | (3E,7Z,11Z)-2-methoxy-3-(2-methoxyethoxy)-7,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145122350 |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | (3E,7Z,11Z)-2-methoxy-3-(2-methoxyethoxy)-7,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;2-methylprop-2-enal |
| SMILES | C=C(/C=C(\OCCOC)C(=C)OC)C(=C)/C(C)=C\C(=C)C(C)/C=C\C(C)CC.C=C(C)C=O |
| InChI | InChI=1S/C25H38O3.C4H6O/c1-11-18(2)12-13-19(3)20(4)16-21(5)23(7)22(6)17-25(24(8)27-10)28-15-14-26-9;1-4(2)3-5/h12-13,16-19H,4,6-8,11,14-15H2,1-3,5,9-10H3;3H,1H2,2H3/b13-12-,21-16-,25-17+; |
| InChIKey | BLPPEKBOUAHVSI-BRSIYCRKSA-N |
| XLogP | 7.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|