C33H38O12 — CID 59641447
2-[2-[2-[2-[(2E,4E,7Z,8E,9Z,10E)-1,12-dioxo-7,8,9-tris(2-oxoethylidene)-6-[(Z)-3-oxoprop-1-enyl]dodeca-2,4,10-trien-4-yl]oxyethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 59641447) has the molecular formula C33H38O12 and a molecular weight of 626.66 g/mol. Its IUPAC name is 2-[2-[2-[2-[(2E,4E,7Z,8E,9Z,10E)-1,12-dioxo-7,8,9-tris(2-oxoethylidene)-6-[(Z)-3-oxoprop-1-enyl]dodeca-2,4,10-trien-4-yl]oxyethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[2-[(2E,4E,7Z,8E,9Z,10E)-1,12-dioxo-7,8,9-tris(2-oxoethylidene)-6-[(Z)-3-oxoprop-1-enyl]dodeca-2,4,10-trien-4-yl]oxyethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59641447 |
| Molecular Formula | C33H38O12 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | 2-[2-[2-[2-[(2E,4E,7Z,8E,9Z,10E)-1,12-dioxo-7,8,9-tris(2-oxoethylidene)-6-[(Z)-3-oxoprop-1-enyl]dodeca-2,4,10-trien-4-yl]oxyethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCOCCOC(/C=C/C=O)=C/C(/C=C\C=O)C(=C/C=O)/C(=C/C=O)C(=C\C=O)/C=C/C=O |
| InChI | InChI=1S/C33H38O12/c1-27(2)33(40)45-25-23-43-21-19-41-18-20-42-22-24-44-30(8-5-14-36)26-29(7-4-13-35)32(11-17-39)31(10-16-38)28(9-15-37)6-3-12-34/h3-17,26,29H,1,18-25H2,2H3/b6-3+,7-4-,8-5+,28-9-,30-26+,31-10+,32-11- |
| InChIKey | DWKZKPNNLWJDKU-QYZGTCAUSA-N |
| XLogP | 2.31 |
| TPSA | 165.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|