C31H46O3 — CID 145122212
acetaldehyde;(3Z,7Z,11E)-8-ethyl-12-(2-methoxyethoxy)-2-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene;prop-1-ene (PubChem CID 145122212) has the molecular formula C31H46O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is acetaldehyde;(3Z,7Z,11E)-8-ethyl-12-(2-methoxyethoxy)-2-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene;prop-1-ene.
| Compound Name | acetaldehyde;(3Z,7Z,11E)-8-ethyl-12-(2-methoxyethoxy)-2-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene;prop-1-ene |
|---|---|
| PubChem CID | 145122212 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | acetaldehyde;(3Z,7Z,11E)-8-ethyl-12-(2-methoxyethoxy)-2-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene;prop-1-ene |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C=C(/CC)C(=C)C(=C)/C=C(/OCCOC)C(=C)CC.C=CC.CC=O |
| InChI | InChI=1S/C26H36O2.C3H6.C2H4O/c1-11-20(5)26(28-16-15-27-10)18-23(8)24(9)25(12-2)17-22(7)21(6)14-13-19(3)4;1-3-2;1-2-3/h13-14,17-18H,3,5-9,11-12,15-16H2,1-2,4,10H3;3H,1H2,2H3;2H,1H3/b14-13-,25-17-,26-18+;; |
| InChIKey | TYMYQYNSJQOBNC-PPJRKNNASA-N |
| XLogP | 8.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|