C22H32O3 — CID 145122186
2-[(3E,7Z)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-trien-4-yl]oxyethyl acetate;prop-1-ene (PubChem CID 145122186) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-[(3E,7Z)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-trien-4-yl]oxyethyl acetate;prop-1-ene.
| Compound Name | 2-[(3E,7Z)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-trien-4-yl]oxyethyl acetate;prop-1-ene |
|---|---|
| PubChem CID | 145122186 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 2-[(3E,7Z)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-trien-4-yl]oxyethyl acetate;prop-1-ene |
| SMILES | C=C(C)/C=C(/OCCOC(C)=O)C(=C)C(=C)/C=C\C(=C)CC.C=CC |
| InChI | InChI=1S/C19H26O3.C3H6/c1-8-15(4)9-10-16(5)17(6)19(13-14(2)3)22-12-11-21-18(7)20;1-3-2/h9-10,13H,2,4-6,8,11-12H2,1,3,7H3;3H,1H2,2H3/b10-9-,19-13+; |
| InChIKey | JCVYOJLIOSOZKS-KIKOSTIWSA-N |
| XLogP | 5.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|