C26H34O4 — CID 145122509
(3Z,7E,11Z)-13-methoxy-7-(2-methoxyethoxy)-2-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene;prop-2-enal (PubChem CID 145122509) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (3Z,7E,11Z)-13-methoxy-7-(2-methoxyethoxy)-2-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene;prop-2-enal.
| Compound Name | (3Z,7E,11Z)-13-methoxy-7-(2-methoxyethoxy)-2-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene;prop-2-enal |
|---|---|
| PubChem CID | 145122509 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (3Z,7E,11Z)-13-methoxy-7-(2-methoxyethoxy)-2-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene;prop-2-enal |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C(=C\C(=C)C(=C)/C=C\C(=C)OC)OCCOC.C=CC=O |
| InChI | InChI=1S/C23H30O3.C3H4O/c1-17(2)10-11-19(4)22(7)23(26-15-14-24-8)16-20(5)18(3)12-13-21(6)25-9;1-2-3-4/h10-13,16H,1,3-7,14-15H2,2,8-9H3;2-3H,1H2/b11-10-,13-12-,23-16+; |
| InChIKey | YMGHBQFHKPUQBS-HZIWLIROSA-N |
| XLogP | 5.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|