C23H40O3 — CID 145122611
acetaldehyde;(3E,6E)-4-(2-methoxyethoxy)-2,6,9-trimethyl-5-methylideneundeca-1,3,6-triene;prop-1-ene (PubChem CID 145122611) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is acetaldehyde;(3E,6E)-4-(2-methoxyethoxy)-2,6,9-trimethyl-5-methylideneundeca-1,3,6-triene;prop-1-ene.
| Compound Name | acetaldehyde;(3E,6E)-4-(2-methoxyethoxy)-2,6,9-trimethyl-5-methylideneundeca-1,3,6-triene;prop-1-ene |
|---|---|
| PubChem CID | 145122611 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | acetaldehyde;(3E,6E)-4-(2-methoxyethoxy)-2,6,9-trimethyl-5-methylideneundeca-1,3,6-triene;prop-1-ene |
| SMILES | C=C(C)/C=C(/OCCOC)C(=C)/C(C)=C/CC(C)CC.C=CC.CC=O |
| InChI | InChI=1S/C18H30O2.C3H6.C2H4O/c1-8-15(4)9-10-16(5)17(6)18(13-14(2)3)20-12-11-19-7;1-3-2;1-2-3/h10,13,15H,2,6,8-9,11-12H2,1,3-5,7H3;3H,1H2,2H3;2H,1H3/b16-10+,18-13+;; |
| InChIKey | VZPFLRYEOBOWCC-OGZSKABYSA-N |
| XLogP | 6.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|