C21H30O2 — CID 145121924
(3Z,7E)-2-methyl-5,6,9-trimethylidene-8-[2-(2-methylprop-2-enoxy)ethoxy]undeca-1,3,7-triene (PubChem CID 145121924) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (3Z,7E)-2-methyl-5,6,9-trimethylidene-8-[2-(2-methylprop-2-enoxy)ethoxy]undeca-1,3,7-triene.
| Compound Name | (3Z,7E)-2-methyl-5,6,9-trimethylidene-8-[2-(2-methylprop-2-enoxy)ethoxy]undeca-1,3,7-triene |
|---|---|
| PubChem CID | 145121924 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (3Z,7E)-2-methyl-5,6,9-trimethylidene-8-[2-(2-methylprop-2-enoxy)ethoxy]undeca-1,3,7-triene |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C=C(\OCCOCC(=C)C)C(=C)CC |
| InChI | InChI=1S/C21H30O2/c1-9-18(6)21(23-13-12-22-15-17(4)5)14-20(8)19(7)11-10-16(2)3/h10-11,14H,2,4,6-9,12-13,15H2,1,3,5H3/b11-10-,21-14+ |
| InChIKey | LTYWRXCEZZRGCN-XMQYJYGRSA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|