C10H15FO2 — CID 169135905
(3E)-5-fluoro-3-(2-methoxyethoxy)-2-methylhexa-1,3,5-triene (PubChem CID 169135905) has the molecular formula C10H15FO2 and a molecular weight of 186.23 g/mol. Its IUPAC name is (3E)-5-fluoro-3-(2-methoxyethoxy)-2-methylhexa-1,3,5-triene.
| Compound Name | (3E)-5-fluoro-3-(2-methoxyethoxy)-2-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 169135905 |
| Molecular Formula | C10H15FO2 |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (3E)-5-fluoro-3-(2-methoxyethoxy)-2-methylhexa-1,3,5-triene |
| SMILES | C=C(F)/C=C(/OCCOC)C(=C)C |
| InChI | InChI=1S/C10H15FO2/c1-8(2)10(7-9(3)11)13-6-5-12-4/h7H,1,3,5-6H2,2,4H3/b10-7+ |
| InChIKey | NGLTYIYKZARYTH-JXMROGBWSA-N |
| XLogP | 2.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|