C18H25FO2 — CID 145121909
(3E,7E)-4-fluoro-8-(2-methoxyethoxy)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene (PubChem CID 145121909) has the molecular formula C18H25FO2 and a molecular weight of 292.39 g/mol. Its IUPAC name is (3E,7E)-4-fluoro-8-(2-methoxyethoxy)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene.
| Compound Name | (3E,7E)-4-fluoro-8-(2-methoxyethoxy)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene |
|---|---|
| PubChem CID | 145121909 |
| Molecular Formula | C18H25FO2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (3E,7E)-4-fluoro-8-(2-methoxyethoxy)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene |
| SMILES | C=C(C)/C=C(/F)C(=C)C(=C)/C=C(\OCCOC)C(=C)CC |
| InChI | InChI=1S/C18H25FO2/c1-8-14(4)18(21-10-9-20-7)12-15(5)16(6)17(19)11-13(2)3/h11-12H,2,4-6,8-10H2,1,3,7H3/b17-11+,18-12+ |
| InChIKey | NRGMFNCALOMYSU-JYFOCSDGSA-N |
| XLogP | 5.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|