C31H50O4 — CID 145122778
(3E,7Z,11Z)-7-ethyl-2-methoxy-3-(2-methoxyethoxy)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;formaldehyde;2-methylprop-1-ene (PubChem CID 145122778) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is (3E,7Z,11Z)-7-ethyl-2-methoxy-3-(2-methoxyethoxy)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;formaldehyde;2-methylprop-1-ene.
| Compound Name | (3E,7Z,11Z)-7-ethyl-2-methoxy-3-(2-methoxyethoxy)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;formaldehyde;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145122778 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | (3E,7Z,11Z)-7-ethyl-2-methoxy-3-(2-methoxyethoxy)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;formaldehyde;2-methylprop-1-ene |
| SMILES | C=C(/C=C(\OCCOC)C(=C)OC)C(=C)/C(=C\C(=C)C(C)/C=C\C(C)CC)CC.C=C(C)C.C=O |
| InChI | InChI=1S/C26H40O3.C4H8.CH2O/c1-11-19(3)13-14-20(4)21(5)17-25(12-2)23(7)22(6)18-26(24(8)28-10)29-16-15-27-9;1-4(2)3;1-2/h13-14,17-20H,5-8,11-12,15-16H2,1-4,9-10H3;1H2,2-3H3;1H2/b14-13-,25-17-,26-18+;; |
| InChIKey | VWIIBLPAZOFYRL-PPJRKNNASA-N |
| XLogP | 8.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|