C18H23FO2 — CID 142964604
(3E)-3-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-2-yl]oxynona-3,6,8-trienoyl fluoride (PubChem CID 142964604) has the molecular formula C18H23FO2 and a molecular weight of 290.38 g/mol. Its IUPAC name is (3E)-3-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-2-yl]oxynona-3,6,8-trienoyl fluoride.
| Compound Name | (3E)-3-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-2-yl]oxynona-3,6,8-trienoyl fluoride |
|---|---|
| PubChem CID | 142964604 |
| Molecular Formula | C18H23FO2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (3E)-3-methyl-5-[(2E,4Z,6Z)-octa-2,4,6-trien-2-yl]oxynona-3,6,8-trienoyl fluoride |
| SMILES | C=CC=CC(/C=C(\C)CC(=O)F)O/C(C)=C/C=C\C=C/C |
| InChI | InChI=1S/C18H23FO2/c1-5-7-9-10-11-16(4)21-17(12-8-6-2)13-15(3)14-18(19)20/h5-13,17H,2,14H2,1,3-4H3/b7-5-,10-9-,12-8?,15-13+,16-11+ |
| InChIKey | AAWMZTRJYCZFIV-QQCIHVSVSA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|