C10H14O2 — CID 134874439
(3E)-2-methyl-3-propan-2-yloxyhexa-1,3,5-trien-1-one (PubChem CID 134874439) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (3E)-2-methyl-3-propan-2-yloxyhexa-1,3,5-trien-1-one.
| Compound Name | (3E)-2-methyl-3-propan-2-yloxyhexa-1,3,5-trien-1-one |
|---|---|
| PubChem CID | 134874439 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (3E)-2-methyl-3-propan-2-yloxyhexa-1,3,5-trien-1-one |
| SMILES | C=C/C=C(/OC(C)C)C(C)=C=O |
| InChI | InChI=1S/C10H14O2/c1-5-6-10(9(4)7-11)12-8(2)3/h5-6,8H,1H2,2-4H3/b10-6+ |
| InChIKey | XSMVIAPUMSZTCZ-UXBLZVDNSA-N |
| XLogP | 2.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|