C8H10O2 — CID 134894933
(3E)-3-methoxy-5-methylhexa-1,3,5-trien-1-one (PubChem CID 134894933) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is (3E)-3-methoxy-5-methylhexa-1,3,5-trien-1-one.
| Compound Name | (3E)-3-methoxy-5-methylhexa-1,3,5-trien-1-one |
|---|---|
| PubChem CID | 134894933 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (3E)-3-methoxy-5-methylhexa-1,3,5-trien-1-one |
| SMILES | C=C(C)/C=C(\C=C=O)OC |
| InChI | InChI=1S/C8H10O2/c1-7(2)6-8(10-3)4-5-9/h4,6H,1H2,2-3H3/b8-6+ |
| InChIKey | CXCJIHGZHRPGEV-SOFGYWHQSA-N |
| XLogP | 1.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|