C10H15FO — CID 143320133
(3E)-5-fluoro-2-methyl-3-propan-2-yloxyhexa-1,3,5-triene (PubChem CID 143320133) has the molecular formula C10H15FO and a molecular weight of 170.23 g/mol. Its IUPAC name is (3E)-5-fluoro-2-methyl-3-propan-2-yloxyhexa-1,3,5-triene.
| Compound Name | (3E)-5-fluoro-2-methyl-3-propan-2-yloxyhexa-1,3,5-triene |
|---|---|
| PubChem CID | 143320133 |
| Molecular Formula | C10H15FO |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (3E)-5-fluoro-2-methyl-3-propan-2-yloxyhexa-1,3,5-triene |
| SMILES | C=C(F)/C=C(/OC(C)C)C(=C)C |
| InChI | InChI=1S/C10H15FO/c1-7(2)10(6-9(5)11)12-8(3)4/h6,8H,1,5H2,2-4H3/b10-6+ |
| InChIKey | BTJYEIMVVKXNJR-UXBLZVDNSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|