C9H12O2 — CID 134894887
(3E)-3-methoxy-2,5-dimethylhexa-1,3,5-trien-1-one (PubChem CID 134894887) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (3E)-3-methoxy-2,5-dimethylhexa-1,3,5-trien-1-one.
| Compound Name | (3E)-3-methoxy-2,5-dimethylhexa-1,3,5-trien-1-one |
|---|---|
| PubChem CID | 134894887 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (3E)-3-methoxy-2,5-dimethylhexa-1,3,5-trien-1-one |
| SMILES | C=C(C)/C=C(/OC)C(C)=C=O |
| InChI | InChI=1S/C9H12O2/c1-7(2)5-9(11-4)8(3)6-10/h5H,1H2,2-4H3/b9-5+ |
| InChIKey | SOFZDYIHKZDVEZ-WEVVVXLNSA-N |
| XLogP | 1.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|