C18H20F2O2 — CID 145218705
(3Z,5E,10Z,12Z)-5-[(1E)-2,3-difluorobuta-1,3-dienyl]-6-methyl-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one (PubChem CID 145218705) has the molecular formula C18H20F2O2 and a molecular weight of 306.35 g/mol. Its IUPAC name is (3Z,5E,10Z,12Z)-5-[(1E)-2,3-difluorobuta-1,3-dienyl]-6-methyl-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one.
| Compound Name | (3Z,5E,10Z,12Z)-5-[(1E)-2,3-difluorobuta-1,3-dienyl]-6-methyl-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one |
|---|---|
| PubChem CID | 145218705 |
| Molecular Formula | C18H20F2O2 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (3Z,5E,10Z,12Z)-5-[(1E)-2,3-difluorobuta-1,3-dienyl]-6-methyl-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one |
| SMILES | C=C(F)/C(F)=C\C1=C(/C)CC(=O)C/C=C\C=C/COC/C=C\1 |
| InChI | InChI=1S/C18H20F2O2/c1-14-12-17(21)9-5-3-4-6-10-22-11-7-8-16(14)13-18(20)15(2)19/h3-8,13H,2,9-12H2,1H3/b5-3-,6-4-,8-7-,16-14+,18-13+ |
| InChIKey | UQLUOEKRSSTOCR-XPAVPZQPSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|