About (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one
(5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one (PubChem CID 142172534) has the molecular formula C12H17F3O2
and a molecular weight of 250.26 g/mol. Its IUPAC name is (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one.
Molecular Properties
| Compound Name | (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one |
| PubChem CID | 142172534 |
| Molecular Formula | C12H17F3O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one |
| SMILES | CC(=O)CC/C(C)=C/C/C=C\COC(F)(F)F |
| InChI | InChI=1S/C12H17F3O2/c1-10(7-8-11(2)16)6-4-3-5-9-17-12(13,14)15/h3,5-6H,4,7-9H2,1-2H3/b5-3-,10-6+ |
| InChIKey | FXEWNOKLVGOGFR-UTMABKKZSA-N |
| XLogP | 3.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one?
The IUPAC name of (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one (CID 142172534) is (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one.
What is the SMILES notation for (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one?
The canonical SMILES for (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one is CC(=O)CC/C(C)=C/C/C=C\COC(F)(F)F.
What is the InChIKey of (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one?
The InChIKey is FXEWNOKLVGOGFR-UTMABKKZSA-N. The full InChI is InChI=1S/C12H17F3O2/c1-10(7-8-11(2)16)6-4-3-5-9-17-12(13,14)15/h3,5-6H,4,7-9H2,1-2H3/b5-3-,10-6+.
What are the key properties of (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one?
(5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one has a molecular weight of 250.26 g/mol, XLogP of 3.78, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,8Z)-5-methyl-10-(trifluoromethoxy)deca-5,8-dien-2-one is sourced from PubChem (CID 142172534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).