C18H19NO5 — CID 123822399
4-[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethoxy]-3-methoxybenzaldehyde (PubChem CID 123822399) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 4-[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethoxy]-3-methoxybenzaldehyde.
| Compound Name | 4-[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 123822399 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 4-[2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)ethoxy]-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCCn1c(O)c2c(c1O)CC=CC2 |
| InChI | InChI=1S/C18H19NO5/c1-23-16-10-12(11-20)6-7-15(16)24-9-8-19-17(21)13-4-2-3-5-14(13)18(19)22/h2-3,6-7,10-11,21-22H,4-5,8-9H2,1H3 |
| InChIKey | OAJZWCKDUDNNFQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|