C14H15NO5 — CID 123971235
4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-3-methoxybenzaldehyde (PubChem CID 123971235) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-3-methoxybenzaldehyde.
| Compound Name | 4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 123971235 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-[2-(2,5-dihydroxypyrrol-1-yl)ethoxy]-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCCn1c(O)ccc1O |
| InChI | InChI=1S/C14H15NO5/c1-19-12-8-10(9-16)2-3-11(12)20-7-6-15-13(17)4-5-14(15)18/h2-5,8-9,17-18H,6-7H2,1H3 |
| InChIKey | QGIAYJYFFQEZCO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|