About 4-chloro-3,3-diphenoxybutane-2-thione
4-chloro-3,3-diphenoxybutane-2-thione (PubChem CID 123822410) has the molecular formula C16H15ClO2S
and a molecular weight of 306.81 g/mol. Its IUPAC name is 4-chloro-3,3-diphenoxybutane-2-thione.
Molecular Properties
| Compound Name | 4-chloro-3,3-diphenoxybutane-2-thione |
| PubChem CID | 123822410 |
| Molecular Formula | C16H15ClO2S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 4-chloro-3,3-diphenoxybutane-2-thione |
| SMILES | CC(=S)C(CCl)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C16H15ClO2S/c1-13(20)16(12-17,18-14-8-4-2-5-9-14)19-15-10-6-3-7-11-15/h2-11H,12H2,1H3 |
| InChIKey | FOGNTLMFXSSDDZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3,3-diphenoxybutane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3,3-diphenoxybutane-2-thione?
The IUPAC name of 4-chloro-3,3-diphenoxybutane-2-thione (CID 123822410) is 4-chloro-3,3-diphenoxybutane-2-thione.
What is the SMILES notation for 4-chloro-3,3-diphenoxybutane-2-thione?
The canonical SMILES for 4-chloro-3,3-diphenoxybutane-2-thione is CC(=S)C(CCl)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of 4-chloro-3,3-diphenoxybutane-2-thione?
The InChIKey is FOGNTLMFXSSDDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO2S/c1-13(20)16(12-17,18-14-8-4-2-5-9-14)19-15-10-6-3-7-11-15/h2-11H,12H2,1H3.
What are the key properties of 4-chloro-3,3-diphenoxybutane-2-thione?
4-chloro-3,3-diphenoxybutane-2-thione has a molecular weight of 306.81 g/mol, XLogP of 4.47, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3,3-diphenoxybutane-2-thione is sourced from PubChem (CID 123822410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).