C9H8Br3ClO2 — CID 141301187
3,3,3-tribromo-1-chloro-1-phenoxypropan-1-ol (PubChem CID 141301187) has the molecular formula C9H8Br3ClO2 and a molecular weight of 423.33 g/mol. Its IUPAC name is 3,3,3-tribromo-1-chloro-1-phenoxypropan-1-ol.
| Compound Name | 3,3,3-tribromo-1-chloro-1-phenoxypropan-1-ol |
|---|---|
| PubChem CID | 141301187 |
| Molecular Formula | C9H8Br3ClO2 |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 419.78 |
| IUPAC Name | 3,3,3-tribromo-1-chloro-1-phenoxypropan-1-ol |
| SMILES | OC(Cl)(CC(Br)(Br)Br)Oc1ccccc1 |
| InChI | InChI=1S/C9H8Br3ClO2/c10-8(11,12)6-9(13,14)15-7-4-2-1-3-5-7/h1-5,14H,6H2 |
| InChIKey | DUNPZLSEYRWXLN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|