C9H5Br5O — CID 57144642
1,1,2,3,3-pentabromoprop-2-enoxybenzene (PubChem CID 57144642) has the molecular formula C9H5Br5O and a molecular weight of 528.66 g/mol. Its IUPAC name is 1,1,2,3,3-pentabromoprop-2-enoxybenzene.
| Compound Name | 1,1,2,3,3-pentabromoprop-2-enoxybenzene |
|---|---|
| PubChem CID | 57144642 |
| Molecular Formula | C9H5Br5O |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 523.63 |
| IUPAC Name | 1,1,2,3,3-pentabromoprop-2-enoxybenzene |
| SMILES | BrC(Br)=C(Br)C(Br)(Br)Oc1ccccc1 |
| InChI | InChI=1S/C9H5Br5O/c10-7(8(11)12)9(13,14)15-6-4-2-1-3-5-6/h1-5H |
| InChIKey | BNTCAFOMVYXGSP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|