About (2-bromo-1,1-diphenoxyethyl)silane
(2-bromo-1,1-diphenoxyethyl)silane (PubChem CID 173116529) has the molecular formula C14H15BrO2Si
and a molecular weight of 323.26 g/mol. Its IUPAC name is (2-bromo-1,1-diphenoxyethyl)silane.
Molecular Properties
| Compound Name | (2-bromo-1,1-diphenoxyethyl)silane |
| PubChem CID | 173116529 |
| Molecular Formula | C14H15BrO2Si |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | (2-bromo-1,1-diphenoxyethyl)silane |
| SMILES | [SiH3]C(CBr)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C14H15BrO2Si/c15-11-14(18,16-12-7-3-1-4-8-12)17-13-9-5-2-6-10-13/h1-10H,11H2,18H3 |
| InChIKey | BLONAXGUURAWPK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-1,1-diphenoxyethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-1,1-diphenoxyethyl)silane?
The IUPAC name of (2-bromo-1,1-diphenoxyethyl)silane (CID 173116529) is (2-bromo-1,1-diphenoxyethyl)silane.
What is the SMILES notation for (2-bromo-1,1-diphenoxyethyl)silane?
The canonical SMILES for (2-bromo-1,1-diphenoxyethyl)silane is [SiH3]C(CBr)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of (2-bromo-1,1-diphenoxyethyl)silane?
The InChIKey is BLONAXGUURAWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrO2Si/c15-11-14(18,16-12-7-3-1-4-8-12)17-13-9-5-2-6-10-13/h1-10H,11H2,18H3.
What are the key properties of (2-bromo-1,1-diphenoxyethyl)silane?
(2-bromo-1,1-diphenoxyethyl)silane has a molecular weight of 323.26 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-1,1-diphenoxyethyl)silane is sourced from PubChem (CID 173116529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).