C26H43FN6 — CID 123822958
N'-[3-(3-butyl-5-fluoro-5-methylcyclooctyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-piperidin-4-ylethane-1,2-diamine (PubChem CID 123822958) has the molecular formula C26H43FN6 and a molecular weight of 458.67 g/mol. Its IUPAC name is N'-[3-(3-butyl-5-fluoro-5-methylcyclooctyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-piperidin-4-ylethane-1,2-diamine.
| Compound Name | N'-[3-(3-butyl-5-fluoro-5-methylcyclooctyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-piperidin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 123822958 |
| Molecular Formula | C26H43FN6 |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.35 |
| IUPAC Name | N'-[3-(3-butyl-5-fluoro-5-methylcyclooctyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-piperidin-4-ylethane-1,2-diamine |
| SMILES | CCCCC1CC(c2cnn3ccc(NCCNC4CCNCC4)nc23)CCCC(C)(F)C1 |
| InChI | InChI=1S/C26H43FN6/c1-3-4-6-20-17-21(7-5-11-26(2,27)18-20)23-19-31-33-16-10-24(32-25(23)33)30-15-14-29-22-8-12-28-13-9-22/h10,16,19-22,28-29H,3-9,11-15,17-18H2,1-2H3,(H,30,32) |
| InChIKey | NJRYAJMQIJUVGU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 66.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|