C26H43FN6O — CID 137061192
2-ethyl-5-(4-fluoropentyl)-9-piperidin-4-yl-6-oxa-9,12,16,17,20-pentazatricyclo[11.5.2.016,19]icosa-1(19),13(20),14,17-tetraene (PubChem CID 137061192) has the molecular formula C26H43FN6O and a molecular weight of 474.67 g/mol. Its IUPAC name is 2-ethyl-5-(4-fluoropentyl)-9-piperidin-4-yl-6-oxa-9,12,16,17,20-pentazatricyclo[11.5.2.016,19]icosa-1(19),13(20),14,17-tetraene.
| Compound Name | 2-ethyl-5-(4-fluoropentyl)-9-piperidin-4-yl-6-oxa-9,12,16,17,20-pentazatricyclo[11.5.2.016,19]icosa-1(19),13(20),14,17-tetraene |
|---|---|
| PubChem CID | 137061192 |
| Molecular Formula | C26H43FN6O |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | 2-ethyl-5-(4-fluoropentyl)-9-piperidin-4-yl-6-oxa-9,12,16,17,20-pentazatricyclo[11.5.2.016,19]icosa-1(19),13(20),14,17-tetraene |
| SMILES | CCC1CCC(CCCC(C)F)OCCN(C2CCNCC2)CCNc2ccn3ncc1c3n2 |
| InChI | InChI=1S/C26H43FN6O/c1-3-21-7-8-23(6-4-5-20(2)27)34-18-17-32(22-9-12-28-13-10-22)16-14-29-25-11-15-33-26(31-25)24(21)19-30-33/h11,15,19-23,28H,3-10,12-14,16-18H2,1-2H3,(H,29,31) |
| InChIKey | ZTUKQGJBDSETJT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |