C12H16N4O — CID 117103216
3-(oxan-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 117103216) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 3-(oxan-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-(oxan-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 117103216 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 3-(oxan-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Nc1ccnc2c(CC3CCCCO3)cnn12 |
| InChI | InChI=1S/C12H16N4O/c13-11-4-5-14-12-9(8-15-16(11)12)7-10-3-1-2-6-17-10/h4-5,8,10H,1-3,6-7,13H2 |
| InChIKey | ABDAALQSMSEQTH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |